C35H42N6O5 — CID 69063116
(2,6-dimethylphenyl) N-[2-[3-[3-(diethylamino)propylcarbamoyl]anilino]pyrimidin-4-yl]-N-(2,4-dimethoxyphenyl)carbamate (PubChem CID 69063116) has the molecular formula C35H42N6O5 and a molecular weight of 626.76 g/mol. Its IUPAC name is (2,6-dimethylphenyl) N-[2-[3-[3-(diethylamino)propylcarbamoyl]anilino]pyrimidin-4-yl]-N-(2,4-dimethoxyphenyl)carbamate.
| Compound Name | (2,6-dimethylphenyl) N-[2-[3-[3-(diethylamino)propylcarbamoyl]anilino]pyrimidin-4-yl]-N-(2,4-dimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 69063116 |
| Molecular Formula | C35H42N6O5 |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.32 |
| IUPAC Name | (2,6-dimethylphenyl) N-[2-[3-[3-(diethylamino)propylcarbamoyl]anilino]pyrimidin-4-yl]-N-(2,4-dimethoxyphenyl)carbamate |
| SMILES | CCN(CC)CCCNC(=O)c1cccc(Nc2nccc(N(C(=O)Oc3c(C)cccc3C)c3ccc(OC)cc3OC)n2)c1 |
| InChI | InChI=1S/C35H42N6O5/c1-7-40(8-2)21-11-19-36-33(42)26-14-10-15-27(22-26)38-34-37-20-18-31(39-34)41(29-17-16-28(44-5)23-30(29)45-6)35(43)46-32-24(3)12-9-13-25(32)4/h9-10,12-18,20,22-23H,7-8,11,19,21H2,1-6H3,(H,36,42)(H,37,38,39) |
| InChIKey | OLNDYIZDLYBBBP-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|