C36H44N6O5 — CID 69059580
(2,6-dimethylphenyl) N-[2-[4-[4-(diethylamino)butylcarbamoyl]anilino]pyrimidin-4-yl]-N-(2,4-dimethoxyphenyl)carbamate (PubChem CID 69059580) has the molecular formula C36H44N6O5 and a molecular weight of 640.79 g/mol. Its IUPAC name is (2,6-dimethylphenyl) N-[2-[4-[4-(diethylamino)butylcarbamoyl]anilino]pyrimidin-4-yl]-N-(2,4-dimethoxyphenyl)carbamate.
| Compound Name | (2,6-dimethylphenyl) N-[2-[4-[4-(diethylamino)butylcarbamoyl]anilino]pyrimidin-4-yl]-N-(2,4-dimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 69059580 |
| Molecular Formula | C36H44N6O5 |
| Molecular Weight | 640.79 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | (2,6-dimethylphenyl) N-[2-[4-[4-(diethylamino)butylcarbamoyl]anilino]pyrimidin-4-yl]-N-(2,4-dimethoxyphenyl)carbamate |
| SMILES | CCN(CC)CCCCNC(=O)c1ccc(Nc2nccc(N(C(=O)Oc3c(C)cccc3C)c3ccc(OC)cc3OC)n2)cc1 |
| InChI | InChI=1S/C36H44N6O5/c1-7-41(8-2)23-10-9-21-37-34(43)27-14-16-28(17-15-27)39-35-38-22-20-32(40-35)42(30-19-18-29(45-5)24-31(30)46-6)36(44)47-33-25(3)12-11-13-26(33)4/h11-20,22,24H,7-10,21,23H2,1-6H3,(H,37,43)(H,38,39,40) |
| InChIKey | HCMFXQUADZATGJ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.79 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|