C26H28Cl2FN5O3 — CID 69069866
(2,5-dichlorophenyl)methyl-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid (PubChem CID 69069866) has the molecular formula C26H28Cl2FN5O3 and a molecular weight of 548.45 g/mol. Its IUPAC name is (2,5-dichlorophenyl)methyl-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid.
| Compound Name | (2,5-dichlorophenyl)methyl-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 69069866 |
| Molecular Formula | C26H28Cl2FN5O3 |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | (2,5-dichlorophenyl)methyl-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid |
| SMILES | O=C(O)N(Cc1cc(Cl)ccc1Cl)c1ccnc(Nc2ccc(OCCCN3CCCCC3)c(F)c2)n1 |
| InChI | InChI=1S/C26H28Cl2FN5O3/c27-19-5-7-21(28)18(15-19)17-34(26(35)36)24-9-10-30-25(32-24)31-20-6-8-23(22(29)16-20)37-14-4-13-33-11-2-1-3-12-33/h5-10,15-16H,1-4,11-14,17H2,(H,35,36)(H,30,31,32) |
| InChIKey | RMXTWIXHXVBKLG-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|