C27H30F3N5O4 — CID 154364293
[2-[4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]-[[2-(trifluoromethoxy)phenyl]methyl]carbamic acid (PubChem CID 154364293) has the molecular formula C27H30F3N5O4 and a molecular weight of 545.56 g/mol. Its IUPAC name is [2-[4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]-[[2-(trifluoromethoxy)phenyl]methyl]carbamic acid.
| Compound Name | [2-[4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]-[[2-(trifluoromethoxy)phenyl]methyl]carbamic acid |
|---|---|
| PubChem CID | 154364293 |
| Molecular Formula | C27H30F3N5O4 |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | [2-[4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]-[[2-(trifluoromethoxy)phenyl]methyl]carbamic acid |
| SMILES | O=C(O)N(Cc1ccccc1OC(F)(F)F)c1ccnc(Nc2ccc(OCCCN3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C27H30F3N5O4/c28-27(29,30)39-23-8-3-2-7-20(23)19-35(26(36)37)24-13-14-31-25(33-24)32-21-9-11-22(12-10-21)38-18-6-17-34-15-4-1-5-16-34/h2-3,7-14H,1,4-6,15-19H2,(H,36,37)(H,31,32,33) |
| InChIKey | FRJBNVNVWDNGJO-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|