C29H38N6O5 — CID 154456156
[2-[3,4-dimethoxy-5-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]-(2,4-dimethylphenyl)carbamic acid (PubChem CID 154456156) has the molecular formula C29H38N6O5 and a molecular weight of 550.66 g/mol. Its IUPAC name is [2-[3,4-dimethoxy-5-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]-(2,4-dimethylphenyl)carbamic acid.
| Compound Name | [2-[3,4-dimethoxy-5-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]-(2,4-dimethylphenyl)carbamic acid |
|---|---|
| PubChem CID | 154456156 |
| Molecular Formula | C29H38N6O5 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | [2-[3,4-dimethoxy-5-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]-(2,4-dimethylphenyl)carbamic acid |
| SMILES | COc1cc(Nc2nccc(N(C(=O)O)c3ccc(C)cc3C)n2)cc(OCCCN2CCN(C)CC2)c1OC |
| InChI | InChI=1S/C29H38N6O5/c1-20-7-8-23(21(2)17-20)35(29(36)37)26-9-10-30-28(32-26)31-22-18-24(38-4)27(39-5)25(19-22)40-16-6-11-34-14-12-33(3)13-15-34/h7-10,17-19H,6,11-16H2,1-5H3,(H,36,37)(H,30,31,32) |
| InChIKey | QMDBJJDIKIHXCU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|