C24H25ClF2N6O2 — CID 154456345
(5-chloro-2-fluorophenyl) N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-methylcarbamate (PubChem CID 154456345) has the molecular formula C24H25ClF2N6O2 and a molecular weight of 502.95 g/mol. Its IUPAC name is (5-chloro-2-fluorophenyl) N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-methylcarbamate.
| Compound Name | (5-chloro-2-fluorophenyl) N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 154456345 |
| Molecular Formula | C24H25ClF2N6O2 |
| Molecular Weight | 502.95 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | (5-chloro-2-fluorophenyl) N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-methylcarbamate |
| SMILES | CC1CN(c2ccc(Nc3nccc(N(C)C(=O)Oc4cc(Cl)ccc4F)n3)cc2F)CCN1C |
| InChI | InChI=1S/C24H25ClF2N6O2/c1-15-14-33(11-10-31(15)2)20-7-5-17(13-19(20)27)29-23-28-9-8-22(30-23)32(3)24(34)35-21-12-16(25)4-6-18(21)26/h4-9,12-13,15H,10-11,14H2,1-3H3,(H,28,29,30) |
| InChIKey | BZVJVLZMMJYKNB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.95 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|