C24H27FN6O3 — CID 87887856
methyl N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-phenylcarbamoperoxoate (PubChem CID 87887856) has the molecular formula C24H27FN6O3 and a molecular weight of 466.52 g/mol. Its IUPAC name is methyl N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-phenylcarbamoperoxoate.
| Compound Name | methyl N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-phenylcarbamoperoxoate |
|---|---|
| PubChem CID | 87887856 |
| Molecular Formula | C24H27FN6O3 |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | methyl N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-phenylcarbamoperoxoate |
| SMILES | COOC(=O)N(c1ccccc1)c1ccnc(Nc2ccc(N3CCN(C)C(C)C3)c(F)c2)n1 |
| InChI | InChI=1S/C24H27FN6O3/c1-17-16-30(14-13-29(17)2)21-10-9-18(15-20(21)25)27-23-26-12-11-22(28-23)31(24(32)34-33-3)19-7-5-4-6-8-19/h4-12,15,17H,13-14,16H2,1-3H3,(H,26,27,28) |
| InChIKey | GWWWWDDKPQWTTN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|