C24H25F3N6O2 — CID 154256885
(3,5-difluorophenyl) N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-methylcarbamate (PubChem CID 154256885) has the molecular formula C24H25F3N6O2 and a molecular weight of 486.50 g/mol. Its IUPAC name is (3,5-difluorophenyl) N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-methylcarbamate.
| Compound Name | (3,5-difluorophenyl) N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 154256885 |
| Molecular Formula | C24H25F3N6O2 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | (3,5-difluorophenyl) N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-methylcarbamate |
| SMILES | CC1CN(c2ccc(Nc3nccc(N(C)C(=O)Oc4cc(F)cc(F)c4)n3)cc2F)CCN1C |
| InChI | InChI=1S/C24H25F3N6O2/c1-15-14-33(9-8-31(15)2)21-5-4-18(13-20(21)27)29-23-28-7-6-22(30-23)32(3)24(34)35-19-11-16(25)10-17(26)12-19/h4-7,10-13,15H,8-9,14H2,1-3H3,(H,28,29,30) |
| InChIKey | SCIRUNGZXFSQAX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|