C33H37FN6O4 — CID 69068425
[(1S)-1-phenylethyl] N-(2,4-dimethoxyphenyl)-N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]carbamate (PubChem CID 69068425) has the molecular formula C33H37FN6O4 and a molecular weight of 600.70 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] N-(2,4-dimethoxyphenyl)-N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]carbamate.
| Compound Name | [(1S)-1-phenylethyl] N-(2,4-dimethoxyphenyl)-N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 69068425 |
| Molecular Formula | C33H37FN6O4 |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | [(1S)-1-phenylethyl] N-(2,4-dimethoxyphenyl)-N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]carbamate |
| SMILES | COc1ccc(N(C(=O)O[C@@H](C)c2ccccc2)c2ccnc(Nc3ccc(N4CCN(C)C(C)C4)c(F)c3)n2)c(OC)c1 |
| InChI | InChI=1S/C33H37FN6O4/c1-22-21-39(18-17-38(22)3)28-13-11-25(19-27(28)34)36-32-35-16-15-31(37-32)40(29-14-12-26(42-4)20-30(29)43-5)33(41)44-23(2)24-9-7-6-8-10-24/h6-16,19-20,22-23H,17-18,21H2,1-5H3,(H,35,36,37)/t22?,23-/m0/s1 |
| InChIKey | GEEJEBWEOURODW-WCSIJFPASA-N |
| XLogP | 6.55 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|