C31H35N7O5 — CID 69201258
pyridin-3-ylmethyl N-(2,4-dimethoxyphenyl)-N-[2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamate (PubChem CID 69201258) has the molecular formula C31H35N7O5 and a molecular weight of 585.67 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-(2,4-dimethoxyphenyl)-N-[2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamate.
| Compound Name | pyridin-3-ylmethyl N-(2,4-dimethoxyphenyl)-N-[2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 69201258 |
| Molecular Formula | C31H35N7O5 |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | pyridin-3-ylmethyl N-(2,4-dimethoxyphenyl)-N-[2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamate |
| SMILES | COc1ccc(N(C(=O)OCc2cccnc2)c2ccnc(Nc3ccc(N4CCN(C)CC4)c(OC)c3)n2)c(OC)c1 |
| InChI | InChI=1S/C31H35N7O5/c1-36-14-16-37(17-15-36)25-9-7-23(18-27(25)41-3)34-30-33-13-11-29(35-30)38(26-10-8-24(40-2)19-28(26)42-4)31(39)43-21-22-6-5-12-32-20-22/h5-13,18-20H,14-17,21H2,1-4H3,(H,33,34,35) |
| InChIKey | WUBCSJQVYIMMGC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|