C23H23Cl2FN6O2 — CID 154456312
(2,5-dichlorophenyl) N-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-N-methylcarbamate (PubChem CID 154456312) has the molecular formula C23H23Cl2FN6O2 and a molecular weight of 505.38 g/mol. Its IUPAC name is (2,5-dichlorophenyl) N-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-N-methylcarbamate.
| Compound Name | (2,5-dichlorophenyl) N-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 154456312 |
| Molecular Formula | C23H23Cl2FN6O2 |
| Molecular Weight | 505.38 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | (2,5-dichlorophenyl) N-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-N-methylcarbamate |
| SMILES | CN1CCN(c2ccc(Nc3nccc(N(C)C(=O)Oc4cc(Cl)ccc4Cl)n3)cc2F)CC1 |
| InChI | InChI=1S/C23H23Cl2FN6O2/c1-30-9-11-32(12-10-30)19-6-4-16(14-18(19)26)28-22-27-8-7-21(29-22)31(2)23(33)34-20-13-15(24)3-5-17(20)25/h3-8,13-14H,9-12H2,1-2H3,(H,27,28,29) |
| InChIKey | JHYSYBOVWOGGSN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|