C30H30ClFN6O2 — CID 69065935
4-(2-chlorophenoxy)-N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 69065935) has the molecular formula C30H30ClFN6O2 and a molecular weight of 561.06 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-(2-chlorophenoxy)-N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 69065935 |
| Molecular Formula | C30H30ClFN6O2 |
| Molecular Weight | 561.06 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 4-(2-chlorophenoxy)-N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cnc(Nc2ccc(N3CCN(C)CC3)c(F)c2)nc1Oc1ccccc1Cl |
| InChI | InChI=1S/C30H30ClFN6O2/c1-19-7-6-8-20(2)27(19)35-28(39)22-18-33-30(36-29(22)40-26-10-5-4-9-23(26)31)34-21-11-12-25(24(32)17-21)38-15-13-37(3)14-16-38/h4-12,17-18H,13-16H2,1-3H3,(H,35,39)(H,33,34,36) |
| InChIKey | WRIDWEOKFUAFTE-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.06 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|