C32H35ClN6O3 — CID 11330740
2-[3-chloro-4-(4-methylpiperazin-1-yl)anilino]-N-(2,6-dimethylphenyl)-4-(2-ethoxyphenoxy)pyrimidine-5-carboxamide (PubChem CID 11330740) has the molecular formula C32H35ClN6O3 and a molecular weight of 587.12 g/mol. Its IUPAC name is 2-[3-chloro-4-(4-methylpiperazin-1-yl)anilino]-N-(2,6-dimethylphenyl)-4-(2-ethoxyphenoxy)pyrimidine-5-carboxamide.
| Compound Name | 2-[3-chloro-4-(4-methylpiperazin-1-yl)anilino]-N-(2,6-dimethylphenyl)-4-(2-ethoxyphenoxy)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 11330740 |
| Molecular Formula | C32H35ClN6O3 |
| Molecular Weight | 587.12 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | 2-[3-chloro-4-(4-methylpiperazin-1-yl)anilino]-N-(2,6-dimethylphenyl)-4-(2-ethoxyphenoxy)pyrimidine-5-carboxamide |
| SMILES | CCOc1ccccc1Oc1nc(Nc2ccc(N3CCN(C)CC3)c(Cl)c2)ncc1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C32H35ClN6O3/c1-5-41-27-11-6-7-12-28(27)42-31-24(30(40)36-29-21(2)9-8-10-22(29)3)20-34-32(37-31)35-23-13-14-26(25(33)19-23)39-17-15-38(4)16-18-39/h6-14,19-20H,5,15-18H2,1-4H3,(H,36,40)(H,34,35,37) |
| InChIKey | WXPWVXWLEUOPOR-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.12 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|