C32H34Cl2N6O2 — CID 69064349
4-(3,4-dichlorophenoxy)-N-(2,6-dimethylphenyl)-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 69064349) has the molecular formula C32H34Cl2N6O2 and a molecular weight of 605.57 g/mol. Its IUPAC name is 4-(3,4-dichlorophenoxy)-N-(2,6-dimethylphenyl)-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-(3,4-dichlorophenoxy)-N-(2,6-dimethylphenyl)-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 69064349 |
| Molecular Formula | C32H34Cl2N6O2 |
| Molecular Weight | 605.57 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | 4-(3,4-dichlorophenoxy)-N-(2,6-dimethylphenyl)-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cnc(Nc2ccc(N3CCN(C(C)C)CC3)cc2)nc1Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C32H34Cl2N6O2/c1-20(2)39-14-16-40(17-15-39)24-10-8-23(9-11-24)36-32-35-19-26(30(41)37-29-21(3)6-5-7-22(29)4)31(38-32)42-25-12-13-27(33)28(34)18-25/h5-13,18-20H,14-17H2,1-4H3,(H,37,41)(H,35,36,38) |
| InChIKey | YXXDMVLRLKVLNJ-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.57 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|