C34H37N7O3 — CID 69063404
N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-4-[3-(2-oxopyrrolidin-1-yl)phenoxy]pyrimidine-5-carboxamide (PubChem CID 69063404) has the molecular formula C34H37N7O3 and a molecular weight of 591.72 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-4-[3-(2-oxopyrrolidin-1-yl)phenoxy]pyrimidine-5-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-4-[3-(2-oxopyrrolidin-1-yl)phenoxy]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 69063404 |
| Molecular Formula | C34H37N7O3 |
| Molecular Weight | 591.72 g/mol |
| Exact Mass | 591.30 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-4-[3-(2-oxopyrrolidin-1-yl)phenoxy]pyrimidine-5-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1Oc1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C34H37N7O3/c1-23-7-4-8-24(2)31(23)37-32(43)29-22-35-34(36-25-12-14-26(15-13-25)40-19-17-39(3)18-20-40)38-33(29)44-28-10-5-9-27(21-28)41-16-6-11-30(41)42/h4-5,7-10,12-15,21-22H,6,11,16-20H2,1-3H3,(H,37,43)(H,35,36,38) |
| InChIKey | KDFXLUGQOBIJSG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.72 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|