C28H35F2N7O — CID 175467004
4-(3,3-difluorobutylamino)-N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 175467004) has the molecular formula C28H35F2N7O and a molecular weight of 523.63 g/mol. Its IUPAC name is 4-(3,3-difluorobutylamino)-N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-(3,3-difluorobutylamino)-N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 175467004 |
| Molecular Formula | C28H35F2N7O |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | 4-(3,3-difluorobutylamino)-N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1NCCC(C)(F)F |
| InChI | InChI=1S/C28H35F2N7O/c1-19-6-5-7-20(2)24(19)34-26(38)23-18-32-27(35-25(23)31-13-12-28(3,29)30)33-21-8-10-22(11-9-21)37-16-14-36(4)15-17-37/h5-11,18H,12-17H2,1-4H3,(H,34,38)(H2,31,32,33,35) |
| InChIKey | DCFPHOATLVVCRK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|