C33H39N7O3 — CID 169088861
4-(2,4-dimethoxyanilino)-N-(2,6-dimethylphenyl)-2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 169088861) has the molecular formula C33H39N7O3 and a molecular weight of 581.72 g/mol. Its IUPAC name is 4-(2,4-dimethoxyanilino)-N-(2,6-dimethylphenyl)-2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-(2,4-dimethoxyanilino)-N-(2,6-dimethylphenyl)-2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 169088861 |
| Molecular Formula | C33H39N7O3 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | 4-(2,4-dimethoxyanilino)-N-(2,6-dimethylphenyl)-2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | CCN1CCN(c2ccc(Nc3ncc(C(=O)Nc4c(C)cccc4C)c(Nc4ccc(OC)cc4OC)n3)cc2)CC1 |
| InChI | InChI=1S/C33H39N7O3/c1-6-39-16-18-40(19-17-39)25-12-10-24(11-13-25)35-33-34-21-27(32(41)37-30-22(2)8-7-9-23(30)3)31(38-33)36-28-15-14-26(42-4)20-29(28)43-5/h7-15,20-21H,6,16-19H2,1-5H3,(H,37,41)(H2,34,35,36,38) |
| InChIKey | PIPOFTYSNABTTD-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|