C24H29N7O2 — CID 44536053
4-(2-methoxyanilino)-N-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 44536053) has the molecular formula C24H29N7O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 4-(2-methoxyanilino)-N-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-(2-methoxyanilino)-N-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 44536053 |
| Molecular Formula | C24H29N7O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 4-(2-methoxyanilino)-N-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | CNC(=O)c1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1Nc1ccccc1OC |
| InChI | InChI=1S/C24H29N7O2/c1-25-23(32)19-16-26-24(29-22(19)28-20-6-4-5-7-21(20)33-3)27-17-8-10-18(11-9-17)31-14-12-30(2)13-15-31/h4-11,16H,12-15H2,1-3H3,(H,25,32)(H2,26,27,28,29) |
| InChIKey | VOVVVIRLWURODT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|