C28H35N7O2 — CID 169088851
4-(cyclobutylamino)-N-(2-methoxy-6-methylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 169088851) has the molecular formula C28H35N7O2 and a molecular weight of 501.64 g/mol. Its IUPAC name is 4-(cyclobutylamino)-N-(2-methoxy-6-methylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-(cyclobutylamino)-N-(2-methoxy-6-methylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 169088851 |
| Molecular Formula | C28H35N7O2 |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | 4-(cyclobutylamino)-N-(2-methoxy-6-methylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | COc1cccc(C)c1NC(=O)c1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1NC1CCC1 |
| InChI | InChI=1S/C28H35N7O2/c1-19-6-4-9-24(37-3)25(19)32-27(36)23-18-29-28(33-26(23)30-20-7-5-8-20)31-21-10-12-22(13-11-21)35-16-14-34(2)15-17-35/h4,6,9-13,18,20H,5,7-8,14-17H2,1-3H3,(H,32,36)(H2,29,30,31,33) |
| InChIKey | BRJWUCHPFVOANB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|