C31H33FN6O3 — CID 69066789
N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-4-(2-methoxyphenoxy)pyrimidine-5-carboxamide (PubChem CID 69066789) has the molecular formula C31H33FN6O3 and a molecular weight of 556.64 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-4-(2-methoxyphenoxy)pyrimidine-5-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-4-(2-methoxyphenoxy)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 69066789 |
| Molecular Formula | C31H33FN6O3 |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-4-(2-methoxyphenoxy)pyrimidine-5-carboxamide |
| SMILES | COc1ccccc1Oc1nc(Nc2ccc(N3CCN(C)CC3)c(F)c2)ncc1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C31H33FN6O3/c1-20-8-7-9-21(2)28(20)35-29(39)23-19-33-31(36-30(23)41-27-11-6-5-10-26(27)40-4)34-22-12-13-25(24(32)18-22)38-16-14-37(3)15-17-38/h5-13,18-19H,14-17H2,1-4H3,(H,35,39)(H,33,34,36) |
| InChIKey | FLCRJOZUDZBMBK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|