C37H41FN8O4 — CID 69067062
N-(2,6-dimethylphenyl)-2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]-4-[2-methoxy-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]phenoxy]pyrimidine-5-carboxamide (PubChem CID 69067062) has the molecular formula C37H41FN8O4 and a molecular weight of 680.79 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]-4-[2-methoxy-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]phenoxy]pyrimidine-5-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]-4-[2-methoxy-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]phenoxy]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 69067062 |
| Molecular Formula | C37H41FN8O4 |
| Molecular Weight | 680.79 g/mol |
| Exact Mass | 680.32 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]-4-[2-methoxy-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]phenoxy]pyrimidine-5-carboxamide |
| SMILES | COc1cc(CCc2nc(C)no2)ccc1Oc1nc(Nc2ccc(N3CCN(C)C(C)C3)c(F)c2)ncc1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C37H41FN8O4/c1-22-8-7-9-23(2)34(22)42-35(47)28-20-39-37(41-27-12-13-30(29(38)19-27)46-17-16-45(5)24(3)21-46)43-36(28)49-31-14-10-26(18-32(31)48-6)11-15-33-40-25(4)44-50-33/h7-10,12-14,18-20,24H,11,15-17,21H2,1-6H3,(H,42,47)(H,39,41,43) |
| InChIKey | TUSNKOJLGBJYPT-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.79 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|