C32H35FN6O2 — CID 69064706
N-(2,6-dimethylphenyl)-4-(2-ethylphenoxy)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 69064706) has the molecular formula C32H35FN6O2 and a molecular weight of 554.67 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-(2-ethylphenoxy)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-(2-ethylphenoxy)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 69064706 |
| Molecular Formula | C32H35FN6O2 |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-(2-ethylphenoxy)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | CCc1ccccc1Oc1nc(Nc2ccc(N3CCN(C)CC3)c(F)c2)ncc1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C32H35FN6O2/c1-5-23-11-6-7-12-28(23)41-31-25(30(40)36-29-21(2)9-8-10-22(29)3)20-34-32(37-31)35-24-13-14-27(26(33)19-24)39-17-15-38(4)16-18-39/h6-14,19-20H,5,15-18H2,1-4H3,(H,36,40)(H,34,35,37) |
| InChIKey | IZANUMYCNVOSTH-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|