C35H39FN6O4 — CID 69071617
4-(3-acetamidophenoxy)-N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide (PubChem CID 69071617) has the molecular formula C35H39FN6O4 and a molecular weight of 626.73 g/mol. Its IUPAC name is 4-(3-acetamidophenoxy)-N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-(3-acetamidophenoxy)-N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 69071617 |
| Molecular Formula | C35H39FN6O4 |
| Molecular Weight | 626.73 g/mol |
| Exact Mass | 626.30 |
| IUPAC Name | 4-(3-acetamidophenoxy)-N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide |
| SMILES | CC(=O)Nc1cccc(Oc2nc(Nc3ccc(OCCCN4CCCCC4)c(F)c3)ncc2C(=O)Nc2c(C)cccc2C)c1 |
| InChI | InChI=1S/C35H39FN6O4/c1-23-10-7-11-24(2)32(23)40-33(44)29-22-37-35(41-34(29)46-28-13-8-12-26(20-28)38-25(3)43)39-27-14-15-31(30(36)21-27)45-19-9-18-42-16-5-4-6-17-42/h7-8,10-15,20-22H,4-6,9,16-19H2,1-3H3,(H,38,43)(H,40,44)(H,37,39,41) |
| InChIKey | IUDMOAWKZXGXNA-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.73 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|