C36H41FN6O4 — CID 11215874
4-[2-(dimethylcarbamoyl)phenoxy]-N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide (PubChem CID 11215874) has the molecular formula C36H41FN6O4 and a molecular weight of 640.76 g/mol. Its IUPAC name is 4-[2-(dimethylcarbamoyl)phenoxy]-N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-[2-(dimethylcarbamoyl)phenoxy]-N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 11215874 |
| Molecular Formula | C36H41FN6O4 |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 640.32 |
| IUPAC Name | 4-[2-(dimethylcarbamoyl)phenoxy]-N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cnc(Nc2ccc(OCCCN3CCCCC3)c(F)c2)nc1Oc1ccccc1C(=O)N(C)C |
| InChI | InChI=1S/C36H41FN6O4/c1-24-12-10-13-25(2)32(24)40-33(44)28-23-38-36(41-34(28)47-30-15-7-6-14-27(30)35(45)42(3)4)39-26-16-17-31(29(37)22-26)46-21-11-20-43-18-8-5-9-19-43/h6-7,10,12-17,22-23H,5,8-9,11,18-21H2,1-4H3,(H,40,44)(H,38,39,41) |
| InChIKey | CCECQKRWDRWBJJ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|