C38H45ClN6O4 — CID 69068715
4-[2-chloro-4-(diethylcarbamoyl)phenoxy]-N-(2,6-dimethylphenyl)-2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide (PubChem CID 69068715) has the molecular formula C38H45ClN6O4 and a molecular weight of 685.27 g/mol. Its IUPAC name is 4-[2-chloro-4-(diethylcarbamoyl)phenoxy]-N-(2,6-dimethylphenyl)-2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-[2-chloro-4-(diethylcarbamoyl)phenoxy]-N-(2,6-dimethylphenyl)-2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 69068715 |
| Molecular Formula | C38H45ClN6O4 |
| Molecular Weight | 685.27 g/mol |
| Exact Mass | 684.32 |
| IUPAC Name | 4-[2-chloro-4-(diethylcarbamoyl)phenoxy]-N-(2,6-dimethylphenyl)-2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(Oc2nc(Nc3cccc(OCCCN4CCCCC4)c3)ncc2C(=O)Nc2c(C)cccc2C)c(Cl)c1 |
| InChI | InChI=1S/C38H45ClN6O4/c1-5-45(6-2)37(47)28-17-18-33(32(39)23-28)49-36-31(35(46)42-34-26(3)13-10-14-27(34)4)25-40-38(43-36)41-29-15-11-16-30(24-29)48-22-12-21-44-19-8-7-9-20-44/h10-11,13-18,23-25H,5-9,12,19-22H2,1-4H3,(H,42,46)(H,40,41,43) |
| InChIKey | LAYASIACWOEXEI-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.27 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|