C43H42FN7O3 — CID 69066232
N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]-4-[3-(2-phenylpyrimidin-4-yl)phenoxy]pyrimidine-5-carboxamide (PubChem CID 69066232) has the molecular formula C43H42FN7O3 and a molecular weight of 723.85 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]-4-[3-(2-phenylpyrimidin-4-yl)phenoxy]pyrimidine-5-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]-4-[3-(2-phenylpyrimidin-4-yl)phenoxy]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 69066232 |
| Molecular Formula | C43H42FN7O3 |
| Molecular Weight | 723.85 g/mol |
| Exact Mass | 723.33 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]-4-[3-(2-phenylpyrimidin-4-yl)phenoxy]pyrimidine-5-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cnc(Nc2ccc(OCCCN3CCCCC3)c(F)c2)nc1Oc1cccc(-c2ccnc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C43H42FN7O3/c1-29-12-9-13-30(2)39(29)49-41(52)35-28-46-43(47-33-18-19-38(36(44)27-33)53-25-11-24-51-22-7-4-8-23-51)50-42(35)54-34-17-10-16-32(26-34)37-20-21-45-40(48-37)31-14-5-3-6-15-31/h3,5-6,9-10,12-21,26-28H,4,7-8,11,22-25H2,1-2H3,(H,49,52)(H,46,47,50) |
| InChIKey | WKRJVUSFMWZWGQ-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.85 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|