C32H33Cl2FN6O4 — CID 69063649
N-(2,6-dichlorophenyl)-2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]-4-(3-methoxyphenoxy)pyrimidine-5-carboxamide (PubChem CID 69063649) has the molecular formula C32H33Cl2FN6O4 and a molecular weight of 655.56 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]-4-(3-methoxyphenoxy)pyrimidine-5-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]-4-(3-methoxyphenoxy)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 69063649 |
| Molecular Formula | C32H33Cl2FN6O4 |
| Molecular Weight | 655.56 g/mol |
| Exact Mass | 654.19 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]-4-(3-methoxyphenoxy)pyrimidine-5-carboxamide |
| SMILES | COc1cccc(Oc2nc(Nc3ccc(OCCCN4CCN(C)CC4)c(F)c3)ncc2C(=O)Nc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C32H33Cl2FN6O4/c1-40-13-15-41(16-14-40)12-5-17-44-28-11-10-21(18-27(28)35)37-32-36-20-24(30(42)38-29-25(33)8-4-9-26(29)34)31(39-32)45-23-7-3-6-22(19-23)43-2/h3-4,6-11,18-20H,5,12-17H2,1-2H3,(H,38,42)(H,36,37,39) |
| InChIKey | UWZJNNAMBDDYCN-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.56 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|