C36H39ClF2N6O4 — CID 69066619
4-[2-chloro-4-(diethylcarbamoyl)phenoxy]-N-(2-fluorophenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide (PubChem CID 69066619) has the molecular formula C36H39ClF2N6O4 and a molecular weight of 693.20 g/mol. Its IUPAC name is 4-[2-chloro-4-(diethylcarbamoyl)phenoxy]-N-(2-fluorophenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-[2-chloro-4-(diethylcarbamoyl)phenoxy]-N-(2-fluorophenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 69066619 |
| Molecular Formula | C36H39ClF2N6O4 |
| Molecular Weight | 693.20 g/mol |
| Exact Mass | 692.27 |
| IUPAC Name | 4-[2-chloro-4-(diethylcarbamoyl)phenoxy]-N-(2-fluorophenyl)-2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidine-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(Oc2nc(Nc3ccc(OCCCN4CCCCC4)c(F)c3)ncc2C(=O)Nc2ccccc2F)c(Cl)c1 |
| InChI | InChI=1S/C36H39ClF2N6O4/c1-3-45(4-2)35(47)24-13-15-31(27(37)21-24)49-34-26(33(46)42-30-12-7-6-11-28(30)38)23-40-36(43-34)41-25-14-16-32(29(39)22-25)48-20-10-19-44-17-8-5-9-18-44/h6-7,11-16,21-23H,3-5,8-10,17-20H2,1-2H3,(H,42,46)(H,40,41,43) |
| InChIKey | JJCVKQUCKGXTCU-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.20 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|