C31H33FN6O4 — CID 87877621
N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-4-methylperoxy-6-phenoxypyrimidine-5-carboxamide (PubChem CID 87877621) has the molecular formula C31H33FN6O4 and a molecular weight of 572.64 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-4-methylperoxy-6-phenoxypyrimidine-5-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-4-methylperoxy-6-phenoxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 87877621 |
| Molecular Formula | C31H33FN6O4 |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-4-methylperoxy-6-phenoxypyrimidine-5-carboxamide |
| SMILES | COOc1nc(Nc2ccc(N3CCN(C)CC3)c(F)c2)nc(Oc2ccccc2)c1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C31H33FN6O4/c1-20-9-8-10-21(2)27(20)34-28(39)26-29(41-23-11-6-5-7-12-23)35-31(36-30(26)42-40-4)33-22-13-14-25(24(32)19-22)38-17-15-37(3)16-18-38/h5-14,19H,15-18H2,1-4H3,(H,34,39)(H,33,35,36) |
| InChIKey | YOJQHSZALRHAKK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|