C35H43N7O4 — CID 87691109
2-[4-[4-[3-(dimethylamino)propyl]piperazin-1-yl]anilino]-N-(2,6-dimethylphenyl)-4-methylperoxy-6-phenoxypyrimidine-5-carboxamide (PubChem CID 87691109) has the molecular formula C35H43N7O4 and a molecular weight of 625.77 g/mol. Its IUPAC name is 2-[4-[4-[3-(dimethylamino)propyl]piperazin-1-yl]anilino]-N-(2,6-dimethylphenyl)-4-methylperoxy-6-phenoxypyrimidine-5-carboxamide.
| Compound Name | 2-[4-[4-[3-(dimethylamino)propyl]piperazin-1-yl]anilino]-N-(2,6-dimethylphenyl)-4-methylperoxy-6-phenoxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 87691109 |
| Molecular Formula | C35H43N7O4 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | 2-[4-[4-[3-(dimethylamino)propyl]piperazin-1-yl]anilino]-N-(2,6-dimethylphenyl)-4-methylperoxy-6-phenoxypyrimidine-5-carboxamide |
| SMILES | COOc1nc(Nc2ccc(N3CCN(CCCN(C)C)CC3)cc2)nc(Oc2ccccc2)c1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C35H43N7O4/c1-25-11-9-12-26(2)31(25)37-32(43)30-33(45-29-13-7-6-8-14-29)38-35(39-34(30)46-44-5)36-27-15-17-28(18-16-27)42-23-21-41(22-24-42)20-10-19-40(3)4/h6-9,11-18H,10,19-24H2,1-5H3,(H,37,43)(H,36,38,39) |
| InChIKey | ASFQLHDOBHBWQZ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|