C36H39FN6O4 — CID 69071663
N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-imidazol-1-ylbutoxy)anilino]-4-(2-methoxy-4-propylphenoxy)pyrimidine-5-carboxamide (PubChem CID 69071663) has the molecular formula C36H39FN6O4 and a molecular weight of 638.74 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-imidazol-1-ylbutoxy)anilino]-4-(2-methoxy-4-propylphenoxy)pyrimidine-5-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-imidazol-1-ylbutoxy)anilino]-4-(2-methoxy-4-propylphenoxy)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 69071663 |
| Molecular Formula | C36H39FN6O4 |
| Molecular Weight | 638.74 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[3-fluoro-4-(4-imidazol-1-ylbutoxy)anilino]-4-(2-methoxy-4-propylphenoxy)pyrimidine-5-carboxamide |
| SMILES | CCCc1ccc(Oc2nc(Nc3ccc(OCCCCn4ccnc4)c(F)c3)ncc2C(=O)Nc2c(C)cccc2C)c(OC)c1 |
| InChI | InChI=1S/C36H39FN6O4/c1-5-9-26-12-14-31(32(20-26)45-4)47-35-28(34(44)41-33-24(2)10-8-11-25(33)3)22-39-36(42-35)40-27-13-15-30(29(37)21-27)46-19-7-6-17-43-18-16-38-23-43/h8,10-16,18,20-23H,5-7,9,17,19H2,1-4H3,(H,41,44)(H,39,40,42) |
| InChIKey | VBLRRCLAYHHJJP-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.74 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|