C33H39N5O5 — CID 69064412
N-(2,6-dimethylphenyl)-4-(2-ethoxyphenoxy)-2-[3-methoxy-4-[2-(propan-2-ylamino)ethoxy]anilino]pyrimidine-5-carboxamide (PubChem CID 69064412) has the molecular formula C33H39N5O5 and a molecular weight of 585.71 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-(2-ethoxyphenoxy)-2-[3-methoxy-4-[2-(propan-2-ylamino)ethoxy]anilino]pyrimidine-5-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-(2-ethoxyphenoxy)-2-[3-methoxy-4-[2-(propan-2-ylamino)ethoxy]anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 69064412 |
| Molecular Formula | C33H39N5O5 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-(2-ethoxyphenoxy)-2-[3-methoxy-4-[2-(propan-2-ylamino)ethoxy]anilino]pyrimidine-5-carboxamide |
| SMILES | CCOc1ccccc1Oc1nc(Nc2ccc(OCCNC(C)C)c(OC)c2)ncc1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C33H39N5O5/c1-7-41-26-13-8-9-14-28(26)43-32-25(31(39)37-30-22(4)11-10-12-23(30)5)20-35-33(38-32)36-24-15-16-27(29(19-24)40-6)42-18-17-34-21(2)3/h8-16,19-21,34H,7,17-18H2,1-6H3,(H,37,39)(H,35,36,38) |
| InChIKey | SXCKYYOEVUTMDO-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|