C33H34ClF3N6O2 — CID 91188685
(2,4,6-trimethylphenyl) N-[(2-chloro-3,6-difluorophenyl)methyl]-N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]carbamate (PubChem CID 91188685) has the molecular formula C33H34ClF3N6O2 and a molecular weight of 639.12 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) N-[(2-chloro-3,6-difluorophenyl)methyl]-N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]carbamate.
| Compound Name | (2,4,6-trimethylphenyl) N-[(2-chloro-3,6-difluorophenyl)methyl]-N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 91188685 |
| Molecular Formula | C33H34ClF3N6O2 |
| Molecular Weight | 639.12 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | (2,4,6-trimethylphenyl) N-[(2-chloro-3,6-difluorophenyl)methyl]-N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]carbamate |
| SMILES | Cc1cc(C)c(OC(=O)N(Cc2c(F)ccc(F)c2Cl)c2ccnc(Nc3ccc(N4CCN(C)C(C)C4)c(F)c3)n2)c(C)c1 |
| InChI | InChI=1S/C33H34ClF3N6O2/c1-19-14-20(2)31(21(3)15-19)45-33(44)43(18-24-25(35)7-8-26(36)30(24)34)29-10-11-38-32(40-29)39-23-6-9-28(27(37)16-23)42-13-12-41(5)22(4)17-42/h6-11,14-16,22H,12-13,17-18H2,1-5H3,(H,38,39,40) |
| InChIKey | QSFKRDRNBLACGS-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.12 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|