C19H22N6S — CID 10090332
4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine (PubChem CID 10090332) has the molecular formula C19H22N6S and a molecular weight of 366.49 g/mol. Its IUPAC name is 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine.
| Compound Name | 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 10090332 |
| Molecular Formula | C19H22N6S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine |
| SMILES | Cc1nc(C)c(-c2ccnc(Nc3ccc(N4CCNCC4)cc3)n2)s1 |
| InChI | InChI=1S/C19H22N6S/c1-13-18(26-14(2)22-13)17-7-8-21-19(24-17)23-15-3-5-16(6-4-15)25-11-9-20-10-12-25/h3-8,20H,9-12H2,1-2H3,(H,21,23,24) |
| InChIKey | XIPYRBORUPIYLH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|