C41H48N14OS2 — CID 174512390
2,4-bis[4-[4-[[4-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]pentan-3-one (PubChem CID 174512390) has the molecular formula C41H48N14OS2 and a molecular weight of 817.07 g/mol. Its IUPAC name is 2,4-bis[4-[4-[[4-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]pentan-3-one.
| Compound Name | 2,4-bis[4-[4-[[4-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]pentan-3-one |
|---|---|
| PubChem CID | 174512390 |
| Molecular Formula | C41H48N14OS2 |
| Molecular Weight | 817.07 g/mol |
| Exact Mass | 816.36 |
| IUPAC Name | 2,4-bis[4-[4-[[4-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]pentan-3-one |
| SMILES | Cc1nc(N)sc1-c1ccnc(Nc2ccc(N3CCN(C(C)C(=O)C(C)N4CCN(c5ccc(Nc6nccc(-c7sc(N)nc7C)n6)cc5)CC4)CC3)cc2)n1 |
| InChI | InChI=1S/C41H48N14OS2/c1-25-36(57-38(42)46-25)33-13-15-44-40(50-33)48-29-5-9-31(10-6-29)54-21-17-52(18-22-54)27(3)35(56)28(4)53-19-23-55(24-20-53)32-11-7-30(8-12-32)49-41-45-16-14-34(51-41)37-26(2)47-39(43)58-37/h5-16,27-28H,17-24H2,1-4H3,(H2,42,46)(H2,43,47)(H,44,48,50)(H,45,49,51) |
| InChIKey | PUBBOCWFVGWVAA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 183.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.07 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|