C30H35N7OS — CID 175251018
2-[4-[4-[[4-[4-methyl-2-[methyl(2-phenylethyl)amino]-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]propanal (PubChem CID 175251018) has the molecular formula C30H35N7OS and a molecular weight of 541.73 g/mol. Its IUPAC name is 2-[4-[4-[[4-[4-methyl-2-[methyl(2-phenylethyl)amino]-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]propanal.
| Compound Name | 2-[4-[4-[[4-[4-methyl-2-[methyl(2-phenylethyl)amino]-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]propanal |
|---|---|
| PubChem CID | 175251018 |
| Molecular Formula | C30H35N7OS |
| Molecular Weight | 541.73 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 2-[4-[4-[[4-[4-methyl-2-[methyl(2-phenylethyl)amino]-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]propanal |
| SMILES | Cc1nc(N(C)CCc2ccccc2)sc1-c1ccnc(Nc2ccc(N3CCN(C(C)C=O)CC3)cc2)n1 |
| InChI | InChI=1S/C30H35N7OS/c1-22(21-38)36-17-19-37(20-18-36)26-11-9-25(10-12-26)33-29-31-15-13-27(34-29)28-23(2)32-30(39-28)35(3)16-14-24-7-5-4-6-8-24/h4-13,15,21-22H,14,16-20H2,1-3H3,(H,31,33,34) |
| InChIKey | IPRIQAOLYJDYLU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.73 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|