C25H25N7OS — CID 68937841
1-[4-[4-[[4-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanone (PubChem CID 68937841) has the molecular formula C25H25N7OS and a molecular weight of 471.59 g/mol. Its IUPAC name is 1-[4-[4-[[4-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[[4-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 68937841 |
| Molecular Formula | C25H25N7OS |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 1-[4-[4-[[4-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(Nc3nccc(-c4sc(-c5cccnc5)nc4C)n3)cc2)CC1 |
| InChI | InChI=1S/C25H25N7OS/c1-17-23(34-24(28-17)19-4-3-10-26-16-19)22-9-11-27-25(30-22)29-20-5-7-21(8-6-20)32-14-12-31(13-15-32)18(2)33/h3-11,16H,12-15H2,1-2H3,(H,27,29,30) |
| InChIKey | NCMYVERLHGKOAK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|