C20H25N7S — CID 24752189
N-ethyl-4-methyl-5-[2-(4-piperazin-1-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine (PubChem CID 24752189) has the molecular formula C20H25N7S and a molecular weight of 395.54 g/mol. Its IUPAC name is N-ethyl-4-methyl-5-[2-(4-piperazin-1-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine.
| Compound Name | N-ethyl-4-methyl-5-[2-(4-piperazin-1-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 24752189 |
| Molecular Formula | C20H25N7S |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-ethyl-4-methyl-5-[2-(4-piperazin-1-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine |
| SMILES | CCNc1nc(C)c(-c2ccnc(Nc3ccc(N4CCNCC4)cc3)n2)s1 |
| InChI | InChI=1S/C20H25N7S/c1-3-22-20-24-14(2)18(28-20)17-8-9-23-19(26-17)25-15-4-6-16(7-5-15)27-12-10-21-11-13-27/h4-9,21H,3,10-13H2,1-2H3,(H,22,24)(H,23,25,26) |
| InChIKey | GUFQYCOGYHRMAZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|