C21H26N6OS — CID 11538800
N-ethyl-4-methyl-5-[2-(2-methyl-4-morpholin-4-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine (PubChem CID 11538800) has the molecular formula C21H26N6OS and a molecular weight of 410.55 g/mol. Its IUPAC name is N-ethyl-4-methyl-5-[2-(2-methyl-4-morpholin-4-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine.
| Compound Name | N-ethyl-4-methyl-5-[2-(2-methyl-4-morpholin-4-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 11538800 |
| Molecular Formula | C21H26N6OS |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N-ethyl-4-methyl-5-[2-(2-methyl-4-morpholin-4-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine |
| SMILES | CCNc1nc(C)c(-c2ccnc(Nc3ccc(N4CCOCC4)cc3C)n2)s1 |
| InChI | InChI=1S/C21H26N6OS/c1-4-22-21-24-15(3)19(29-21)18-7-8-23-20(26-18)25-17-6-5-16(13-14(17)2)27-9-11-28-12-10-27/h5-8,13H,4,9-12H2,1-3H3,(H,22,24)(H,23,25,26) |
| InChIKey | KOKWGCJIARADQT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|