C15H18ClN3OS — CID 168579906
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-4-morpholin-4-ylaniline (PubChem CID 168579906) has the molecular formula C15H18ClN3OS and a molecular weight of 323.85 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-4-morpholin-4-ylaniline.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 168579906 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-4-morpholin-4-ylaniline |
| SMILES | Cc1cc(N2CCOCC2)ccc1NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C15H18ClN3OS/c1-11-8-12(19-4-6-20-7-5-19)2-3-14(11)17-9-13-10-18-15(16)21-13/h2-3,8,10,17H,4-7,9H2,1H3 |
| InChIKey | SCIRYRUEMZIZEC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|