C20H21ClN4OS — CID 168580131
4-[4-[4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperazin-1-yl]phenol (PubChem CID 168580131) has the molecular formula C20H21ClN4OS and a molecular weight of 400.94 g/mol. Its IUPAC name is 4-[4-[4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperazin-1-yl]phenol.
| Compound Name | 4-[4-[4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 168580131 |
| Molecular Formula | C20H21ClN4OS |
| Molecular Weight | 400.94 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 4-[4-[4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperazin-1-yl]phenol |
| SMILES | Oc1ccc(N2CCN(c3ccc(NCc4cnc(Cl)s4)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H21ClN4OS/c21-20-23-14-19(27-20)13-22-15-1-3-16(4-2-15)24-9-11-25(12-10-24)17-5-7-18(26)8-6-17/h1-8,14,22,26H,9-13H2 |
| InChIKey | SLPBWYWWNGGFGU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.94 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|