C10H10BClN2O2S — CID 168583966
[4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]boronic acid (PubChem CID 168583966) has the molecular formula C10H10BClN2O2S and a molecular weight of 268.53 g/mol. Its IUPAC name is [4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]boronic acid.
| Compound Name | [4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]boronic acid |
|---|---|
| PubChem CID | 168583966 |
| Molecular Formula | C10H10BClN2O2S |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | [4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(NCc2cnc(Cl)s2)cc1 |
| InChI | InChI=1S/C10H10BClN2O2S/c12-10-14-6-9(17-10)5-13-8-3-1-7(2-4-8)11(15)16/h1-4,6,13,15-16H,5H2 |
| InChIKey | UZZZPQQHRXJYKK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|