C10H9ClN2O2S — CID 168582764
2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzene-1,4-diol (PubChem CID 168582764) has the molecular formula C10H9ClN2O2S and a molecular weight of 256.71 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzene-1,4-diol.
| Compound Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzene-1,4-diol |
|---|---|
| PubChem CID | 168582764 |
| Molecular Formula | C10H9ClN2O2S |
| Molecular Weight | 256.71 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(NCc2cnc(Cl)s2)c1 |
| InChI | InChI=1S/C10H9ClN2O2S/c11-10-13-5-7(16-10)4-12-8-3-6(14)1-2-9(8)15/h1-3,5,12,14-15H,4H2 |
| InChIKey | VOHJYXDZDIUWKX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|