C10H7BrClFN2OS — CID 168584289
5-bromo-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-3-fluorophenol (PubChem CID 168584289) has the molecular formula C10H7BrClFN2OS and a molecular weight of 337.60 g/mol. Its IUPAC name is 5-bromo-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-3-fluorophenol.
| Compound Name | 5-bromo-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-3-fluorophenol |
|---|---|
| PubChem CID | 168584289 |
| Molecular Formula | C10H7BrClFN2OS |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 335.91 |
| IUPAC Name | 5-bromo-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-3-fluorophenol |
| SMILES | Oc1cc(Br)cc(F)c1NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C10H7BrClFN2OS/c11-5-1-7(13)9(8(16)2-5)14-3-6-4-15-10(12)17-6/h1-2,4,14,16H,3H2 |
| InChIKey | QIPDSHUBGJCZJH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|