C10H7ClF2N2S2 — CID 168583445
2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-3,5-difluorobenzenethiol (PubChem CID 168583445) has the molecular formula C10H7ClF2N2S2 and a molecular weight of 292.76 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-3,5-difluorobenzenethiol.
| Compound Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-3,5-difluorobenzenethiol |
|---|---|
| PubChem CID | 168583445 |
| Molecular Formula | C10H7ClF2N2S2 |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-3,5-difluorobenzenethiol |
| SMILES | Fc1cc(F)c(NCc2cnc(Cl)s2)c(S)c1 |
| InChI | InChI=1S/C10H7ClF2N2S2/c11-10-15-4-6(17-10)3-14-9-7(13)1-5(12)2-8(9)16/h1-2,4,14,16H,3H2 |
| InChIKey | PUGKDOMFLLOVNS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|