C11H6ClF4IN2S — CID 168582660
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoro-2-iodo-3-(trifluoromethyl)aniline (PubChem CID 168582660) has the molecular formula C11H6ClF4IN2S and a molecular weight of 436.60 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoro-2-iodo-3-(trifluoromethyl)aniline.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoro-2-iodo-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 168582660 |
| Molecular Formula | C11H6ClF4IN2S |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 435.89 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoro-2-iodo-3-(trifluoromethyl)aniline |
| SMILES | Fc1cc(NCc2cnc(Cl)s2)c(I)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H6ClF4IN2S/c12-10-19-4-6(20-10)3-18-8-2-5(13)1-7(9(8)17)11(14,15)16/h1-2,4,18H,3H2 |
| InChIKey | SQHHDMLAIKGRTN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|