C11H6Cl2F3IN2S — CID 168583999
4-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-iodo-5-(trifluoromethyl)aniline (PubChem CID 168583999) has the molecular formula C11H6Cl2F3IN2S and a molecular weight of 453.05 g/mol. Its IUPAC name is 4-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-iodo-5-(trifluoromethyl)aniline.
| Compound Name | 4-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-iodo-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 168583999 |
| Molecular Formula | C11H6Cl2F3IN2S |
| Molecular Weight | 453.05 g/mol |
| Exact Mass | 451.86 |
| IUPAC Name | 4-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-iodo-5-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(NCc2cnc(Cl)s2)c(I)cc1Cl |
| InChI | InChI=1S/C11H6Cl2F3IN2S/c12-7-2-8(17)9(1-6(7)11(14,15)16)18-3-5-4-19-10(13)20-5/h1-2,4,18H,3H2 |
| InChIKey | XGBXFFWDNDLEPG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.05 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|