C13H6Cl3F7N2S — CID 168581353
2,6-dichloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline (PubChem CID 168581353) has the molecular formula C13H6Cl3F7N2S and a molecular weight of 461.62 g/mol. Its IUPAC name is 2,6-dichloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline.
| Compound Name | 2,6-dichloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline |
|---|---|
| PubChem CID | 168581353 |
| Molecular Formula | C13H6Cl3F7N2S |
| Molecular Weight | 461.62 g/mol |
| Exact Mass | 459.92 |
| IUPAC Name | 2,6-dichloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline |
| SMILES | FC(F)(F)C(F)(c1cc(Cl)c(NCc2cnc(Cl)s2)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C13H6Cl3F7N2S/c14-7-1-5(11(17,12(18,19)20)13(21,22)23)2-8(15)9(7)24-3-6-4-25-10(16)26-6/h1-2,4,24H,3H2 |
| InChIKey | LBEWEEMXSLRUEL-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.62 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |