C10H6Cl2F2N2S — CID 168583939
2-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,6-difluoroaniline (PubChem CID 168583939) has the molecular formula C10H6Cl2F2N2S and a molecular weight of 295.14 g/mol. Its IUPAC name is 2-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,6-difluoroaniline.
| Compound Name | 2-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,6-difluoroaniline |
|---|---|
| PubChem CID | 168583939 |
| Molecular Formula | C10H6Cl2F2N2S |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 2-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,6-difluoroaniline |
| SMILES | Fc1ccc(F)c(NCc2cnc(Cl)s2)c1Cl |
| InChI | InChI=1S/C10H6Cl2F2N2S/c11-8-6(13)1-2-7(14)9(8)15-3-5-4-16-10(12)17-5/h1-2,4,15H,3H2 |
| InChIKey | WKABDNLOFFCGRW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|