C12H11ClN2O2S — CID 168580226
1-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-hydroxyphenyl]ethanone (PubChem CID 168580226) has the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. Its IUPAC name is 1-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-hydroxyphenyl]ethanone.
| Compound Name | 1-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-hydroxyphenyl]ethanone |
|---|---|
| PubChem CID | 168580226 |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 1-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-hydroxyphenyl]ethanone |
| SMILES | CC(=O)c1cccc(NCc2cnc(Cl)s2)c1O |
| InChI | InChI=1S/C12H11ClN2O2S/c1-7(16)9-3-2-4-10(11(9)17)14-5-8-6-15-12(13)18-8/h2-4,6,14,17H,5H2,1H3 |
| InChIKey | IAAGOOGMMOPBMI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|